C32H29N5O4S — CID 169222977
N-(4-isoquinolin-8-yloxy-3-methylphenyl)-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine (PubChem CID 169222977) has the molecular formula C32H29N5O4S and a molecular weight of 579.68 g/mol. Its IUPAC name is N-(4-isoquinolin-8-yloxy-3-methylphenyl)-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine.
| Compound Name | N-(4-isoquinolin-8-yloxy-3-methylphenyl)-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 169222977 |
| Molecular Formula | C32H29N5O4S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | N-(4-isoquinolin-8-yloxy-3-methylphenyl)-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3ccc(-c4ccc(CNCCS(C)(=O)=O)o4)cc23)ccc1Oc1cccc2ccncc12 |
| InChI | InChI=1S/C32H29N5O4S/c1-21-16-24(7-10-29(21)41-31-5-3-4-22-12-13-33-19-27(22)31)37-32-26-17-23(6-9-28(26)35-20-36-32)30-11-8-25(40-30)18-34-14-15-42(2,38)39/h3-13,16-17,19-20,34H,14-15,18H2,1-2H3,(H,35,36,37) |
| InChIKey | KIOXFQRQVFVYOZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|