C36H37ClN4O10S3 — CID 175673715
2-chloro-4-[[6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-yl]amino]phenol;bis(4-methylbenzenesulfonic acid) (PubChem CID 175673715) has the molecular formula C36H37ClN4O10S3 and a molecular weight of 817.36 g/mol. Its IUPAC name is 2-chloro-4-[[6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-yl]amino]phenol;bis(4-methylbenzenesulfonic acid).
| Compound Name | 2-chloro-4-[[6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-yl]amino]phenol;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 175673715 |
| Molecular Formula | C36H37ClN4O10S3 |
| Molecular Weight | 817.36 g/mol |
| Exact Mass | 816.14 |
| IUPAC Name | 2-chloro-4-[[6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-yl]amino]phenol;bis(4-methylbenzenesulfonic acid) |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(O)c(Cl)c4)c3c2)o1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H21ClN4O4S.2C7H8O3S/c1-32(29,30)9-8-24-12-16-4-7-21(31-16)14-2-5-19-17(10-14)22(26-13-25-19)27-15-3-6-20(28)18(23)11-15;2*1-6-2-4-7(5-3-6)11(8,9)10/h2-7,10-11,13,24,28H,8-9,12H2,1H3,(H,25,26,27);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | KCTWNTLGVCINPB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 226.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.36 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|