C29H27FN4O5S — CID 69053060
N-[4-(3-fluorophenoxy)-3-methoxyphenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine (PubChem CID 69053060) has the molecular formula C29H27FN4O5S and a molecular weight of 562.62 g/mol. Its IUPAC name is N-[4-(3-fluorophenoxy)-3-methoxyphenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[4-(3-fluorophenoxy)-3-methoxyphenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69053060 |
| Molecular Formula | C29H27FN4O5S |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | N-[4-(3-fluorophenoxy)-3-methoxyphenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-4-amine |
| SMILES | COc1cc(Nc2ncnc3ccc(-c4ccc(CNCCS(C)(=O)=O)o4)cc23)ccc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C29H27FN4O5S/c1-37-28-16-21(7-10-27(28)38-22-5-3-4-20(30)15-22)34-29-24-14-19(6-9-25(24)32-18-33-29)26-11-8-23(39-26)17-31-12-13-40(2,35)36/h3-11,14-16,18,31H,12-13,17H2,1-2H3,(H,32,33,34) |
| InChIKey | VRWQUHSEKKFYEV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|