C20H14N3O2RbS — CID 89173906
N-[4-(benzenesulfonyl)phenyl]-6H-quinazolin-6-id-4-amine;rubidium(1+) (PubChem CID 89173906) has the molecular formula C20H14N3O2RbS and a molecular weight of 445.89 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)phenyl]-6H-quinazolin-6-id-4-amine;rubidium(1+).
| Compound Name | N-[4-(benzenesulfonyl)phenyl]-6H-quinazolin-6-id-4-amine;rubidium(1+) |
|---|---|
| PubChem CID | 89173906 |
| Molecular Formula | C20H14N3O2RbS |
| Molecular Weight | 445.89 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | N-[4-(benzenesulfonyl)phenyl]-6H-quinazolin-6-id-4-amine;rubidium(1+) |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(Nc2ncnc3cc[c-]cc23)cc1.[Rb+] |
| InChI | InChI=1S/C20H14N3O2S.Rb/c24-26(25,16-6-2-1-3-7-16)17-12-10-15(11-13-17)23-20-18-8-4-5-9-19(18)21-14-22-20;/h1-3,5-14H,(H,21,22,23);/q-1;+1 |
| InChIKey | AKAUTTKAMJDMSY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.89 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|