C35H37FN8O2 — CID 143748984
1-[3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-morpholin-4-ylethylamino)propan-2-ol (PubChem CID 143748984) has the molecular formula C35H37FN8O2 and a molecular weight of 620.73 g/mol. Its IUPAC name is 1-[3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-morpholin-4-ylethylamino)propan-2-ol.
| Compound Name | 1-[3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-morpholin-4-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 143748984 |
| Molecular Formula | C35H37FN8O2 |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 1-[3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-morpholin-4-ylethylamino)propan-2-ol |
| SMILES | OC(CNCCN1CCOCC1)Cn1ccc(-c2ccc3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c3c2)c1 |
| InChI | InChI=1S/C35H37FN8O2/c36-29-3-1-2-25(16-29)21-44-34-7-5-30(17-28(34)19-40-44)41-35-32-18-26(4-6-33(32)38-24-39-35)27-8-10-43(22-27)23-31(45)20-37-9-11-42-12-14-46-15-13-42/h1-8,10,16-19,22,24,31,37,45H,9,11-15,20-21,23H2,(H,38,39,41) |
| InChIKey | ZVOMBISJACGYLF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|