C32H34FN7O3S — CID 143748441
1-[3-[4-[4-[(3-fluorophenyl)methylamino]-3-methanimidoylanilino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-methylsulfonylethylamino)propan-2-ol (PubChem CID 143748441) has the molecular formula C32H34FN7O3S and a molecular weight of 615.74 g/mol. Its IUPAC name is 1-[3-[4-[4-[(3-fluorophenyl)methylamino]-3-methanimidoylanilino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-methylsulfonylethylamino)propan-2-ol.
| Compound Name | 1-[3-[4-[4-[(3-fluorophenyl)methylamino]-3-methanimidoylanilino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-methylsulfonylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 143748441 |
| Molecular Formula | C32H34FN7O3S |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 1-[3-[4-[4-[(3-fluorophenyl)methylamino]-3-methanimidoylanilino]quinazolin-6-yl]pyrrol-1-yl]-3-(2-methylsulfonylethylamino)propan-2-ol |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3ccc(-c4ccn(CC(O)CNCCS(C)(=O)=O)c4)cc23)ccc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C32H34FN7O3S/c1-44(42,43)12-10-35-18-28(41)20-40-11-9-24(19-40)23-5-7-31-29(15-23)32(38-21-37-31)39-27-6-8-30(25(14-27)16-34)36-17-22-3-2-4-26(33)13-22/h2-9,11,13-16,19,21,28,34-36,41H,10,12,17-18,20H2,1H3,(H,37,38,39)/b34-16+ |
| InChIKey | XDFMNLRCDVGDGR-AABVJFSESA-N |
| XLogP | 4.59 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|