C17H24BrN5O — CID 21002522
2-[4-[3-[(6-bromoquinazolin-4-yl)amino]propyl]piperazin-1-yl]ethanol (PubChem CID 21002522) has the molecular formula C17H24BrN5O and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-[4-[3-[(6-bromoquinazolin-4-yl)amino]propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-[(6-bromoquinazolin-4-yl)amino]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 21002522 |
| Molecular Formula | C17H24BrN5O |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[4-[3-[(6-bromoquinazolin-4-yl)amino]propyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(CCCNc2ncnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C17H24BrN5O/c18-14-2-3-16-15(12-14)17(21-13-20-16)19-4-1-5-22-6-8-23(9-7-22)10-11-24/h2-3,12-13,24H,1,4-11H2,(H,19,20,21) |
| InChIKey | ACYPPSRXVLANAN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|