C14H16BrN3O2 — CID 133459268
6-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinazolin-4-amine (PubChem CID 133459268) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.20 g/mol. Its IUPAC name is 6-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133459268 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 6-bromo-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]quinazolin-4-amine |
| SMILES | CC1(CCNc2ncnc3ccc(Br)cc23)OCCO1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-14(19-6-7-20-14)4-5-16-13-11-8-10(15)2-3-12(11)17-9-18-13/h2-3,8-9H,4-7H2,1H3,(H,16,17,18) |
| InChIKey | CJVYDWBQLKDJCK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |