C16H22BrN4+ — CID 2061539
6-bromo-N-(4-pyrrolidin-1-ium-1-ylbutyl)quinazolin-4-amine (PubChem CID 2061539) has the molecular formula C16H22BrN4+ and a molecular weight of 350.28 g/mol. Its IUPAC name is 6-bromo-N-(4-pyrrolidin-1-ium-1-ylbutyl)quinazolin-4-amine.
| Compound Name | 6-bromo-N-(4-pyrrolidin-1-ium-1-ylbutyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 2061539 |
| Molecular Formula | C16H22BrN4+ |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 6-bromo-N-(4-pyrrolidin-1-ium-1-ylbutyl)quinazolin-4-amine |
| SMILES | Brc1ccc2ncnc(NCCCC[NH+]3CCCC3)c2c1 |
| InChI | InChI=1S/C16H21BrN4/c17-13-5-6-15-14(11-13)16(20-12-19-15)18-7-1-2-8-21-9-3-4-10-21/h5-6,11-12H,1-4,7-10H2,(H,18,19,20)/p+1 |
| InChIKey | RALUAQDKIYYUIY-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|