C12H12BrN3O2S — CID 154763470
6-bromo-N-[(1,1-dioxothietan-3-yl)methyl]quinazolin-4-amine (PubChem CID 154763470) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 6-bromo-N-[(1,1-dioxothietan-3-yl)methyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[(1,1-dioxothietan-3-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 154763470 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 6-bromo-N-[(1,1-dioxothietan-3-yl)methyl]quinazolin-4-amine |
| SMILES | O=S1(=O)CC(CNc2ncnc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C12H12BrN3O2S/c13-9-1-2-11-10(3-9)12(16-7-15-11)14-4-8-5-19(17,18)6-8/h1-3,7-8H,4-6H2,(H,14,15,16) |
| InChIKey | IRUOUOUOBTXZCP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |