C13H14BrN3S2 — CID 133348873
6-bromo-N-(1,4-dithian-2-ylmethyl)quinazolin-4-amine (PubChem CID 133348873) has the molecular formula C13H14BrN3S2 and a molecular weight of 356.31 g/mol. Its IUPAC name is 6-bromo-N-(1,4-dithian-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 6-bromo-N-(1,4-dithian-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 133348873 |
| Molecular Formula | C13H14BrN3S2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 6-bromo-N-(1,4-dithian-2-ylmethyl)quinazolin-4-amine |
| SMILES | Brc1ccc2ncnc(NCC3CSCCS3)c2c1 |
| InChI | InChI=1S/C13H14BrN3S2/c14-9-1-2-12-11(5-9)13(17-8-16-12)15-6-10-7-18-3-4-19-10/h1-2,5,8,10H,3-4,6-7H2,(H,15,16,17) |
| InChIKey | FWNNEZHASFLEQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |