C17H21BrN4OS — CID 87021044
6-bromo-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]quinazolin-4-amine (PubChem CID 87021044) has the molecular formula C17H21BrN4OS and a molecular weight of 409.35 g/mol. Its IUPAC name is 6-bromo-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87021044 |
| Molecular Formula | C17H21BrN4OS |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 6-bromo-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]quinazolin-4-amine |
| SMILES | Brc1ccc2ncnc(NCC3(N4CCOCC4)CCSC3)c2c1 |
| InChI | InChI=1S/C17H21BrN4OS/c18-13-1-2-15-14(9-13)16(21-12-20-15)19-10-17(3-8-24-11-17)22-4-6-23-7-5-22/h1-2,9,12H,3-8,10-11H2,(H,19,20,21) |
| InChIKey | PPJUNAOBSCBFFI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |