C14H20N6OS — CID 94032387
N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-7H-purin-6-amine (PubChem CID 94032387) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 94032387 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-7H-purin-6-amine |
| SMILES | c1nc(NC[C@]2(N3CCOCC3)CCSC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H20N6OS/c1-6-22-8-14(1,20-2-4-21-5-3-20)7-15-12-11-13(17-9-16-11)19-10-18-12/h9-10H,1-8H2,(H2,15,16,17,18,19)/t14-/m1/s1 |
| InChIKey | GOKVBFHSKUPHJA-CQSZACIVSA-N |
| XLogP | 0.97 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |