C14H22N6 — CID 133491700
N-[[1-[(dimethylamino)methyl]cyclopentyl]methyl]-7H-purin-6-amine (PubChem CID 133491700) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[[1-[(dimethylamino)methyl]cyclopentyl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[1-[(dimethylamino)methyl]cyclopentyl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 133491700 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-[[1-[(dimethylamino)methyl]cyclopentyl]methyl]-7H-purin-6-amine |
| SMILES | CN(C)CC1(CNc2ncnc3nc[nH]c23)CCCC1 |
| InChI | InChI=1S/C14H22N6/c1-20(2)8-14(5-3-4-6-14)7-15-12-11-13(17-9-16-11)19-10-18-12/h9-10H,3-8H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | ZYZUUVBUQIROAQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |