C17H25BrN2O2S — CID 97350588
4-bromo-2-[(1S)-1-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methylamino]ethyl]phenol (PubChem CID 97350588) has the molecular formula C17H25BrN2O2S and a molecular weight of 401.37 g/mol. Its IUPAC name is 4-bromo-2-[(1S)-1-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methylamino]ethyl]phenol.
| Compound Name | 4-bromo-2-[(1S)-1-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 97350588 |
| Molecular Formula | C17H25BrN2O2S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-bromo-2-[(1S)-1-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methylamino]ethyl]phenol |
| SMILES | C[C@H](NC[C@]1(N2CCOCC2)CCSC1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C17H25BrN2O2S/c1-13(15-10-14(18)2-3-16(15)21)19-11-17(4-9-23-12-17)20-5-7-22-8-6-20/h2-3,10,13,19,21H,4-9,11-12H2,1H3/t13-,17+/m0/s1 |
| InChIKey | XDWLCSSIQPQFCB-SUMWQHHRSA-N |
| XLogP | 3.01 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|