C15H24N2OS2 — CID 97230647
(1S)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-1-thiophen-3-ylethanamine (PubChem CID 97230647) has the molecular formula C15H24N2OS2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (1S)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-1-thiophen-3-ylethanamine.
| Compound Name | (1S)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 97230647 |
| Molecular Formula | C15H24N2OS2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1S)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-1-thiophen-3-ylethanamine |
| SMILES | C[C@H](NC[C@]1(N2CCOCC2)CCSC1)c1ccsc1 |
| InChI | InChI=1S/C15H24N2OS2/c1-13(14-2-8-19-10-14)16-11-15(3-9-20-12-15)17-4-6-18-7-5-17/h2,8,10,13,16H,3-7,9,11-12H2,1H3/t13-,15+/m0/s1 |
| InChIKey | NAELKNJHMIUNSG-DZGCQCFKSA-N |
| XLogP | 2.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |