C16H20FN3OS — CID 56786379
5-fluoro-2-[(3-morpholin-4-ylthiolan-3-yl)methylamino]benzonitrile (PubChem CID 56786379) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-fluoro-2-[(3-morpholin-4-ylthiolan-3-yl)methylamino]benzonitrile.
| Compound Name | 5-fluoro-2-[(3-morpholin-4-ylthiolan-3-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 56786379 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-fluoro-2-[(3-morpholin-4-ylthiolan-3-yl)methylamino]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C16H20FN3OS/c17-14-1-2-15(13(9-14)10-18)19-11-16(3-8-22-12-16)20-4-6-21-7-5-20/h1-2,9,19H,3-8,11-12H2 |
| InChIKey | QESWJEIMSJFDFP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |