C15H19FN2O2 — CID 71866561
5-fluoro-2-[[4-(2-hydroxyethyl)oxan-4-yl]methylamino]benzonitrile (PubChem CID 71866561) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-fluoro-2-[[4-(2-hydroxyethyl)oxan-4-yl]methylamino]benzonitrile.
| Compound Name | 5-fluoro-2-[[4-(2-hydroxyethyl)oxan-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 71866561 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-fluoro-2-[[4-(2-hydroxyethyl)oxan-4-yl]methylamino]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCC1(CCO)CCOCC1 |
| InChI | InChI=1S/C15H19FN2O2/c16-13-1-2-14(12(9-13)10-17)18-11-15(3-6-19)4-7-20-8-5-15/h1-2,9,18-19H,3-8,11H2 |
| InChIKey | JNAPJQHFWIQBFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |