C20H20FN3O2 — CID 78896439
1-(2-cyano-4-fluorophenyl)-3-[(4-phenyloxan-4-yl)methyl]urea (PubChem CID 78896439) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[(4-phenyloxan-4-yl)methyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[(4-phenyloxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 78896439 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[(4-phenyloxan-4-yl)methyl]urea |
| SMILES | N#Cc1cc(F)ccc1NC(=O)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C20H20FN3O2/c21-17-6-7-18(15(12-17)13-22)24-19(25)23-14-20(8-10-26-11-9-20)16-4-2-1-3-5-16/h1-7,12H,8-11,14H2,(H2,23,24,25) |
| InChIKey | ZSUCNMDWXXZCPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |