C15H19N3O5S — CID 133405752
2-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]-5-nitrobenzonitrile (PubChem CID 133405752) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 133405752 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]-5-nitrobenzonitrile |
| SMILES | CS(=O)(=O)CC1(CNc2ccc([N+](=O)[O-])cc2C#N)CCOCC1 |
| InChI | InChI=1S/C15H19N3O5S/c1-24(21,22)11-15(4-6-23-7-5-15)10-17-14-3-2-13(18(19)20)8-12(14)9-16/h2-3,8,17H,4-7,10-11H2,1H3 |
| InChIKey | QZJVSHLYIXAGOX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|