C15H20N4O3 — CID 139017550
5-nitro-2-[3-(1,4-oxazepan-4-yl)propylamino]benzonitrile (PubChem CID 139017550) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-nitro-2-[3-(1,4-oxazepan-4-yl)propylamino]benzonitrile.
| Compound Name | 5-nitro-2-[3-(1,4-oxazepan-4-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 139017550 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-nitro-2-[3-(1,4-oxazepan-4-yl)propylamino]benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCCCN1CCCOCC1 |
| InChI | InChI=1S/C15H20N4O3/c16-12-13-11-14(19(20)21)3-4-15(13)17-5-1-6-18-7-2-9-22-10-8-18/h3-4,11,17H,1-2,5-10H2 |
| InChIKey | ZFXYGVCDZIHKLA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|