C17H22N4O4 — CID 75415501
methyl 1-[3-(2-cyano-4-nitroanilino)propyl]piperidine-4-carboxylate (PubChem CID 75415501) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 1-[3-(2-cyano-4-nitroanilino)propyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-(2-cyano-4-nitroanilino)propyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75415501 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 1-[3-(2-cyano-4-nitroanilino)propyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(CCCNc2ccc([N+](=O)[O-])cc2C#N)CC1 |
| InChI | InChI=1S/C17H22N4O4/c1-25-17(22)13-5-9-20(10-6-13)8-2-7-19-16-4-3-15(21(23)24)11-14(16)12-18/h3-4,11,13,19H,2,5-10H2,1H3 |
| InChIKey | WCYSWJVGYGDGMD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|