C15H19FN2O3S — CID 133405829
2-fluoro-6-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]benzonitrile (PubChem CID 133405829) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-fluoro-6-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]benzonitrile.
| Compound Name | 2-fluoro-6-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 133405829 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-fluoro-6-[[4-(methylsulfonylmethyl)oxan-4-yl]methylamino]benzonitrile |
| SMILES | CS(=O)(=O)CC1(CNc2cccc(F)c2C#N)CCOCC1 |
| InChI | InChI=1S/C15H19FN2O3S/c1-22(19,20)11-15(5-7-21-8-6-15)10-18-14-4-2-3-13(16)12(14)9-17/h2-4,18H,5-8,10-11H2,1H3 |
| InChIKey | INGQUBRZHPPLRN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |