About 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile
2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile (PubChem CID 86769475) has the molecular formula C13H15FN2O3S
and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile |
| PubChem CID | 86769475 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile |
| SMILES | N#Cc1c(F)cccc1NCC1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H15FN2O3S/c14-11-2-1-3-12(10(11)8-15)16-9-13(17)4-6-20(18,19)7-5-13/h1-3,16-17H,4-7,9H2 |
| InChIKey | RNTYBDGJDLYHQU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile?
The IUPAC name of 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile (CID 86769475) is 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile.
What is the SMILES notation for 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile?
The canonical SMILES for 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile is N#Cc1c(F)cccc1NCC1(O)CCS(=O)(=O)CC1.
What is the InChIKey of 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile?
The InChIKey is RNTYBDGJDLYHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O3S/c14-11-2-1-3-12(10(11)8-15)16-9-13(17)4-6-20(18,19)7-5-13/h1-3,16-17H,4-7,9H2.
What are the key properties of 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile?
2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile has a molecular weight of 298.34 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[(4-hydroxy-1,1-dioxothian-4-yl)methylamino]benzonitrile is sourced from PubChem (CID 86769475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).