C17H23N3OS — CID 95582569
3-[[[(3S)-3-morpholin-4-ylthiolan-3-yl]methylamino]methyl]benzonitrile (PubChem CID 95582569) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 3-[[[(3S)-3-morpholin-4-ylthiolan-3-yl]methylamino]methyl]benzonitrile.
| Compound Name | 3-[[[(3S)-3-morpholin-4-ylthiolan-3-yl]methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 95582569 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[[[(3S)-3-morpholin-4-ylthiolan-3-yl]methylamino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNC[C@@]2(N3CCOCC3)CCSC2)c1 |
| InChI | InChI=1S/C17H23N3OS/c18-11-15-2-1-3-16(10-15)12-19-13-17(4-9-22-14-17)20-5-7-21-8-6-20/h1-3,10,19H,4-9,12-14H2/t17-/m0/s1 |
| InChIKey | KHMXFKZETJLFQD-KRWDZBQOSA-N |
| XLogP | 1.86 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |