C20H21FN2O — CID 47627698
3-[[[4-(3-fluorophenyl)oxan-4-yl]methylamino]methyl]benzonitrile (PubChem CID 47627698) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-[[[4-(3-fluorophenyl)oxan-4-yl]methylamino]methyl]benzonitrile.
| Compound Name | 3-[[[4-(3-fluorophenyl)oxan-4-yl]methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 47627698 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[[[4-(3-fluorophenyl)oxan-4-yl]methylamino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCC2(c3cccc(F)c3)CCOCC2)c1 |
| InChI | InChI=1S/C20H21FN2O/c21-19-6-2-5-18(12-19)20(7-9-24-10-8-20)15-23-14-17-4-1-3-16(11-17)13-22/h1-6,11-12,23H,7-10,14-15H2 |
| InChIKey | CJJGURVWHREGRZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |