C20H21FN2O3S — CID 86839207
1-(3-cyanophenyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]methanesulfonamide (PubChem CID 86839207) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]methanesulfonamide.
| Compound Name | 1-(3-cyanophenyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 86839207 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]methanesulfonamide |
| SMILES | N#Cc1cccc(CS(=O)(=O)NCC2(c3cccc(F)c3)CCOCC2)c1 |
| InChI | InChI=1S/C20H21FN2O3S/c21-19-6-2-5-18(12-19)20(7-9-26-10-8-20)15-23-27(24,25)14-17-4-1-3-16(11-17)13-22/h1-6,11-12,23H,7-10,14-15H2 |
| InChIKey | WUJYHDQWBNOOLR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |