C18H18ClFN2O5S — CID 86879570
5-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 86879570) has the molecular formula C18H18ClFN2O5S and a molecular weight of 428.87 g/mol. Its IUPAC name is 5-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | 5-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 86879570 |
| Molecular Formula | C18H18ClFN2O5S |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 5-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1S(=O)(=O)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C18H18ClFN2O5S/c19-14-4-5-16(22(23)24)17(11-14)28(25,26)21-12-18(6-8-27-9-7-18)13-2-1-3-15(20)10-13/h1-5,10-11,21H,6-9,12H2 |
| InChIKey | SKFLJKLJWBKHBA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|