C18H17ClF4N2O — CID 60570273
3-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 60570273) has the molecular formula C18H17ClF4N2O and a molecular weight of 388.79 g/mol. Its IUPAC name is 3-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 60570273 |
| Molecular Formula | C18H17ClF4N2O |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-chloro-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1cccc(C2(CNc3ncc(C(F)(F)F)cc3Cl)CCOCC2)c1 |
| InChI | InChI=1S/C18H17ClF4N2O/c19-15-9-13(18(21,22)23)10-24-16(15)25-11-17(4-6-26-7-5-17)12-2-1-3-14(20)8-12/h1-3,8-10H,4-7,11H2,(H,24,25) |
| InChIKey | FQCLZDSHGAQXDC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |