C20H19Cl3FNO3 — CID 52739663
N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 52739663) has the molecular formula C20H19Cl3FNO3 and a molecular weight of 446.73 g/mol. Its IUPAC name is N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 52739663 |
| Molecular Formula | C20H19Cl3FNO3 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C20H19Cl3FNO3/c21-15-9-17(23)18(10-16(15)22)28-11-19(26)25-12-20(4-6-27-7-5-20)13-2-1-3-14(24)8-13/h1-3,8-10H,4-7,11-12H2,(H,25,26) |
| InChIKey | QSRMXMNGYQTRGY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|