C27H25FN2O3 — CID 86954115
3-[(4-cyanophenoxy)methyl]-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]benzamide (PubChem CID 86954115) has the molecular formula C27H25FN2O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is 3-[(4-cyanophenoxy)methyl]-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 3-[(4-cyanophenoxy)methyl]-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 86954115 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[(4-cyanophenoxy)methyl]-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]benzamide |
| SMILES | N#Cc1ccc(OCc2cccc(C(=O)NCC3(c4cccc(F)c4)CCOCC3)c2)cc1 |
| InChI | InChI=1S/C27H25FN2O3/c28-24-6-2-5-23(16-24)27(11-13-32-14-12-27)19-30-26(31)22-4-1-3-21(15-22)18-33-25-9-7-20(17-29)8-10-25/h1-10,15-16H,11-14,18-19H2,(H,30,31) |
| InChIKey | ZHLWJCOZTSBXSO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |