C26H24ClFN2O3 — CID 52737912
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[(4-fluorobenzoyl)amino]benzamide (PubChem CID 52737912) has the molecular formula C26H24ClFN2O3 and a molecular weight of 466.94 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[(4-fluorobenzoyl)amino]benzamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[(4-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 52737912 |
| Molecular Formula | C26H24ClFN2O3 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[(4-fluorobenzoyl)amino]benzamide |
| SMILES | O=C(NCC1(c2cccc(Cl)c2)CCOCC1)c1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H24ClFN2O3/c27-21-5-2-4-20(16-21)26(11-13-33-14-12-26)17-29-24(31)19-3-1-6-23(15-19)30-25(32)18-7-9-22(28)10-8-18/h1-10,15-16H,11-14,17H2,(H,29,31)(H,30,32) |
| InChIKey | NORAGUYCGZWESM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |