C21H27NO4S — CID 27450599
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1-(3-methylphenyl)methanesulfonamide (PubChem CID 27450599) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 27450599 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1-(3-methylphenyl)methanesulfonamide |
| SMILES | COc1ccc(C2(CNS(=O)(=O)Cc3cccc(C)c3)CCOCC2)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-17-4-3-5-18(14-17)15-27(23,24)22-16-21(10-12-26-13-11-21)19-6-8-20(25-2)9-7-19/h3-9,14,22H,10-13,15-16H2,1-2H3 |
| InChIKey | AIMPXMNCQOMYNU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |