C15H23NO3S — CID 110440585
N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]butane-1-sulfonamide (PubChem CID 110440585) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]butane-1-sulfonamide.
| Compound Name | N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110440585 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC1(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C15H23NO3S/c1-3-4-11-20(17,18)16-12-15(9-10-15)13-5-7-14(19-2)8-6-13/h5-8,16H,3-4,9-12H2,1-2H3 |
| InChIKey | NJHPAMZWAKIROQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |