C16H24ClNO3S — CID 110440592
N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]butane-1-sulfonamide (PubChem CID 110440592) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]butane-1-sulfonamide.
| Compound Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110440592 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C16H24ClNO3S/c1-2-3-12-22(19,20)18-13-16(8-10-21-11-9-16)14-4-6-15(17)7-5-14/h4-7,18H,2-3,8-13H2,1H3 |
| InChIKey | YGGGRFQHBDLCLQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |