C18H25ClN2O4S — CID 56586785
N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-cyanobutane-1-sulfonamide (PubChem CID 56586785) has the molecular formula C18H25ClN2O4S and a molecular weight of 400.93 g/mol. Its IUPAC name is N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-cyanobutane-1-sulfonamide.
| Compound Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-cyanobutane-1-sulfonamide |
|---|---|
| PubChem CID | 56586785 |
| Molecular Formula | C18H25ClN2O4S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-cyanobutane-1-sulfonamide |
| SMILES | COc1ccc(Cl)cc1C1(CNS(=O)(=O)CCCCC#N)CCOCC1 |
| InChI | InChI=1S/C18H25ClN2O4S/c1-24-17-6-5-15(19)13-16(17)18(7-10-25-11-8-18)14-21-26(22,23)12-4-2-3-9-20/h5-6,13,21H,2-4,7-8,10-12,14H2,1H3 |
| InChIKey | OTMKOMOCDBXAGJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|