C22H24ClN3O3 — CID 86959987
2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]-2-(4-cyanophenyl)acetamide (PubChem CID 86959987) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]-2-(4-cyanophenyl)acetamide.
| Compound Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]-2-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 86959987 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]-2-(4-cyanophenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1C1(CNC(C(N)=O)c2ccc(C#N)cc2)CCOCC1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-28-19-7-6-17(23)12-18(19)22(8-10-29-11-9-22)14-26-20(21(25)27)16-4-2-15(13-24)3-5-16/h2-7,12,20,26H,8-11,14H2,1H3,(H2,25,27) |
| InChIKey | FSCZIFUDFUSRFO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |