C17H22ClNO4 — CID 95624551
(3R)-3-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]oxolan-2-one (PubChem CID 95624551) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is (3R)-3-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]oxolan-2-one.
| Compound Name | (3R)-3-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]oxolan-2-one |
|---|---|
| PubChem CID | 95624551 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3R)-3-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methylamino]oxolan-2-one |
| SMILES | COc1ccc(Cl)cc1C1(CN[C@@H]2CCOC2=O)CCOCC1 |
| InChI | InChI=1S/C17H22ClNO4/c1-21-15-3-2-12(18)10-13(15)17(5-8-22-9-6-17)11-19-14-4-7-23-16(14)20/h2-3,10,14,19H,4-9,11H2,1H3/t14-/m1/s1 |
| InChIKey | DQLALPJLDLJYQG-CQSZACIVSA-N |
| XLogP | 2.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |