C19H20Cl2FNO4S — CID 52756763
3-chloro-N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 52756763) has the molecular formula C19H20Cl2FNO4S and a molecular weight of 448.34 g/mol. Its IUPAC name is 3-chloro-N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 52756763 |
| Molecular Formula | C19H20Cl2FNO4S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-chloro-N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1C1(CNS(=O)(=O)c2ccc(F)c(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C19H20Cl2FNO4S/c1-26-18-5-2-13(20)10-15(18)19(6-8-27-9-7-19)12-23-28(24,25)14-3-4-17(22)16(21)11-14/h2-5,10-11,23H,6-9,12H2,1H3 |
| InChIKey | NEVTTWBDZBIUCV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |