C20H24ClNO4S — CID 47959613
N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 47959613) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 47959613 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1C1(CNS(=O)(=O)c2ccc(C)cc2)CCOCC1 |
| InChI | InChI=1S/C20H24ClNO4S/c1-15-3-6-17(7-4-15)27(23,24)22-14-20(9-11-26-12-10-20)18-13-16(21)5-8-19(18)25-2/h3-8,13,22H,9-12,14H2,1-2H3 |
| InChIKey | RJRYKZIJBLBEQQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |