C20H24ClNO5S — CID 27450563
3-chloro-4-methoxy-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide (PubChem CID 27450563) has the molecular formula C20H24ClNO5S and a molecular weight of 425.93 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27450563 |
| Molecular Formula | C20H24ClNO5S |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 3-chloro-4-methoxy-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(C2(CNS(=O)(=O)c3ccc(OC)c(Cl)c3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H24ClNO5S/c1-25-16-5-3-15(4-6-16)20(9-11-27-12-10-20)14-22-28(23,24)17-7-8-19(26-2)18(21)13-17/h3-8,13,22H,9-12,14H2,1-2H3 |
| InChIKey | RZRHRAOZKYCNOE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |