C21H27NO3S — CID 42269363
4-tert-butyl-N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]benzenesulfonamide (PubChem CID 42269363) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42269363 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-tert-butyl-N-[[1-(4-methoxyphenyl)cyclopropyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(C2(CNS(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-20(2,3)16-7-11-19(12-8-16)26(23,24)22-15-21(13-14-21)17-5-9-18(25-4)10-6-17/h5-12,22H,13-15H2,1-4H3 |
| InChIKey | RDESWCDWCNJEQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |