C19H23FN2O4S — CID 167840472
4-amino-2-fluoro-N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide (PubChem CID 167840472) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide.
| Compound Name | 4-amino-2-fluoro-N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167840472 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-amino-2-fluoro-N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccccc1C1(CNS(=O)(=O)c2ccc(N)cc2F)CCOCC1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-25-17-5-3-2-4-15(17)19(8-10-26-11-9-19)13-22-27(23,24)18-7-6-14(21)12-16(18)20/h2-7,12,22H,8-11,13,21H2,1H3 |
| InChIKey | OIZAGQWZFWOFSD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|