C20H24ClN3O2 — CID 133298913
N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-2-cyclopropylpyrimidin-4-amine (PubChem CID 133298913) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-2-cyclopropylpyrimidin-4-amine.
| Compound Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133298913 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-2-cyclopropylpyrimidin-4-amine |
| SMILES | COc1ccc(Cl)cc1C1(CNc2ccnc(C3CC3)n2)CCOCC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-25-17-5-4-15(21)12-16(17)20(7-10-26-11-8-20)13-23-18-6-9-22-19(24-18)14-2-3-14/h4-6,9,12,14H,2-3,7-8,10-11,13H2,1H3,(H,22,23,24) |
| InChIKey | AELQWGQPGRDCGF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |