C14H15BrN6 — CID 133324802
6-bromo-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine (PubChem CID 133324802) has the molecular formula C14H15BrN6 and a molecular weight of 347.22 g/mol. Its IUPAC name is 6-bromo-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133324802 |
| Molecular Formula | C14H15BrN6 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 6-bromo-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine |
| SMILES | Brc1ccc2ncnc(NCCCCn3cnnc3)c2c1 |
| InChI | InChI=1S/C14H15BrN6/c15-11-3-4-13-12(7-11)14(18-8-17-13)16-5-1-2-6-21-9-19-20-10-21/h3-4,7-10H,1-2,5-6H2,(H,16,17,18) |
| InChIKey | MZRMXXPLZQMMAH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|