C16H13BrFN3 — CID 25175672
6-bromo-N-[2-(3-fluorophenyl)ethyl]quinazolin-4-amine (PubChem CID 25175672) has the molecular formula C16H13BrFN3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 6-bromo-N-[2-(3-fluorophenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[2-(3-fluorophenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 25175672 |
| Molecular Formula | C16H13BrFN3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 6-bromo-N-[2-(3-fluorophenyl)ethyl]quinazolin-4-amine |
| SMILES | Fc1cccc(CCNc2ncnc3ccc(Br)cc23)c1 |
| InChI | InChI=1S/C16H13BrFN3/c17-12-4-5-15-14(9-12)16(21-10-20-15)19-7-6-11-2-1-3-13(18)8-11/h1-5,8-10H,6-7H2,(H,19,20,21) |
| InChIKey | XKWNOLKTADIHRH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |