C29H32N4O3S — CID 67618217
7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-N-(4-phenylmethoxyphenyl)quinazolin-4-amine (PubChem CID 67618217) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-N-(4-phenylmethoxyphenyl)quinazolin-4-amine.
| Compound Name | 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-N-(4-phenylmethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 67618217 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-N-(4-phenylmethoxyphenyl)quinazolin-4-amine |
| SMILES | O=S1(=O)CCN(CCCCc2ccc3c(Nc4ccc(OCc5ccccc5)cc4)ncnc3c2)CC1 |
| InChI | InChI=1S/C29H32N4O3S/c34-37(35)18-16-33(17-19-37)15-5-4-6-23-9-14-27-28(20-23)30-22-31-29(27)32-25-10-12-26(13-11-25)36-21-24-7-2-1-3-8-24/h1-3,7-14,20,22H,4-6,15-19,21H2,(H,30,31,32) |
| InChIKey | XTJFFAAJCXPFRQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|