C20H16N4O3 — CID 177257041
4-(4-phenylmethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 177257041) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-(4-phenylmethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-(4-phenylmethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 177257041 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-(4-phenylmethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1cc2c(Nc3ccc(OCc4ccccc4)cc3)ncnc2[nH]1 |
| InChI | InChI=1S/C20H16N4O3/c25-20(26)17-10-16-18(21-12-22-19(16)24-17)23-14-6-8-15(9-7-14)27-11-13-4-2-1-3-5-13/h1-10,12H,11H2,(H,25,26)(H2,21,22,23,24) |
| InChIKey | MVGOBCNKEHWPPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |