C30H35N5O4S — CID 67566020
7-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-6-methoxy-4-N-(4-phenylmethoxyphenyl)quinazoline-4,7-diamine (PubChem CID 67566020) has the molecular formula C30H35N5O4S and a molecular weight of 561.71 g/mol. Its IUPAC name is 7-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-6-methoxy-4-N-(4-phenylmethoxyphenyl)quinazoline-4,7-diamine.
| Compound Name | 7-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-6-methoxy-4-N-(4-phenylmethoxyphenyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 67566020 |
| Molecular Formula | C30H35N5O4S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 7-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]-6-methoxy-4-N-(4-phenylmethoxyphenyl)quinazoline-4,7-diamine |
| SMILES | COc1cc2c(Nc3ccc(OCc4ccccc4)cc3)ncnc2cc1NCCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C30H35N5O4S/c1-38-29-19-26-27(20-28(29)31-13-5-6-14-35-15-17-40(36,37)18-16-35)32-22-33-30(26)34-24-9-11-25(12-10-24)39-21-23-7-3-2-4-8-23/h2-4,7-12,19-20,22,31H,5-6,13-18,21H2,1H3,(H,32,33,34) |
| InChIKey | SLAJLBHZSSSORJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|