C31H37N5O8S — CID 85149631
7-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;sulfuric acid (PubChem CID 85149631) has the molecular formula C31H37N5O8S and a molecular weight of 639.73 g/mol. Its IUPAC name is 7-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;sulfuric acid.
| Compound Name | 7-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;sulfuric acid |
|---|---|
| PubChem CID | 85149631 |
| Molecular Formula | C31H37N5O8S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 7-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;sulfuric acid |
| SMILES | COc1cc2ncnc(Nc3ccc(C(C)=NOCc4ccccc4)cc3)c2cc1OCCCN1CCOCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C31H35N5O4.H2O4S/c1-23(35-40-21-24-7-4-3-5-8-24)25-9-11-26(12-10-25)34-31-27-19-30(29(37-2)20-28(27)32-22-33-31)39-16-6-13-36-14-17-38-18-15-36;1-5(2,3)4/h3-5,7-12,19-20,22H,6,13-18,21H2,1-2H3,(H,32,33,34);(H2,1,2,3,4) |
| InChIKey | FVDZIOVBYGMHOE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|